C20H36N2O5 — CID 57224545
propan-2-yl (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate (PubChem CID 57224545) has the molecular formula C20H36N2O5 and a molecular weight of 384.52 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 57224545 |
| Molecular Formula | C20H36N2O5 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate |
| SMILES | C=CC[C@H](C(=O)NO)[C@@H](CC(C)C)C(=O)N[C@H](C(=O)OC(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H36N2O5/c1-9-10-14(18(24)22-26)15(11-12(2)3)17(23)21-16(20(6,7)8)19(25)27-13(4)5/h9,12-16,26H,1,10-11H2,2-8H3,(H,21,23)(H,22,24)/t14-,15+,16+/m0/s1 |
| InChIKey | QMPFNAZFYQTDGH-ARFHVFGLSA-N |
| XLogP | 2.83 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|