C17H17NO — CID 57224737
1-[4-(1,2,3,4-tetrahydroisoquinolin-1-yl)phenyl]ethanone (PubChem CID 57224737) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[4-(1,2,3,4-tetrahydroisoquinolin-1-yl)phenyl]ethanone.
| Compound Name | 1-[4-(1,2,3,4-tetrahydroisoquinolin-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 57224737 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1-[4-(1,2,3,4-tetrahydroisoquinolin-1-yl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(C2NCCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H17NO/c1-12(19)13-6-8-15(9-7-13)17-16-5-3-2-4-14(16)10-11-18-17/h2-9,17-18H,10-11H2,1H3 |
| InChIKey | DXYYUIUSISOVTE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |