C18H26N4O4 — CID 57224762
(2R,3R)-3-(aminomethyl)-2-benzyl-2-(2,5-dihydroxypyrrol-1-yl)-4-(hydroxyamino)-N,3-dimethylbutanamide (PubChem CID 57224762) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is (2R,3R)-3-(aminomethyl)-2-benzyl-2-(2,5-dihydroxypyrrol-1-yl)-4-(hydroxyamino)-N,3-dimethylbutanamide.
| Compound Name | (2R,3R)-3-(aminomethyl)-2-benzyl-2-(2,5-dihydroxypyrrol-1-yl)-4-(hydroxyamino)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 57224762 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (2R,3R)-3-(aminomethyl)-2-benzyl-2-(2,5-dihydroxypyrrol-1-yl)-4-(hydroxyamino)-N,3-dimethylbutanamide |
| SMILES | CNC(=O)[C@](Cc1ccccc1)(n1c(O)ccc1O)[C@](C)(CN)CNO |
| InChI | InChI=1S/C18H26N4O4/c1-17(11-19,12-21-26)18(16(25)20-2,10-13-6-4-3-5-7-13)22-14(23)8-9-15(22)24/h3-9,21,23-24,26H,10-12,19H2,1-2H3,(H,20,25)/t17-,18+/m1/s1 |
| InChIKey | JMSWGZXXOBPGPD-MSOLQXFVSA-N |
| XLogP | 0.53 |
| TPSA | 132.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|