About 1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene
1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene (PubChem CID 57224978) has the molecular formula C7H9NS
and a molecular weight of 139.22 g/mol. Its IUPAC name is 1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene.
Molecular Properties
| Compound Name | 1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene |
| PubChem CID | 57224978 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene |
| SMILES | C1=CC2=CCNCS2=C1 |
| InChI | InChI=1S/C7H9NS/c1-2-7-3-4-8-6-9(7)5-1/h1-3,5,8H,4,6H2 |
| InChIKey | PISUSPCBQIMZRE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene?
The IUPAC name of 1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene (CID 57224978) is 1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene.
What is the SMILES notation for 1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene?
The canonical SMILES for 1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene is C1=CC2=CCNCS2=C1.
What is the InChIKey of 1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene?
The InChIKey is PISUSPCBQIMZRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NS/c1-2-7-3-4-8-6-9(7)5-1/h1-3,5,8H,4,6H2.
What are the key properties of 1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene?
1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene has a molecular weight of 139.22 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1λ4-thia-3-azabicyclo[4.3.0]nona-1(9),5,7-triene is sourced from PubChem (CID 57224978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).