About ethyl 9-chloronon-8-enoate
ethyl 9-chloronon-8-enoate (PubChem CID 57225294) has the molecular formula C11H19ClO2
and a molecular weight of 218.72 g/mol. Its IUPAC name is ethyl 9-chloronon-8-enoate.
Molecular Properties
| Compound Name | ethyl 9-chloronon-8-enoate |
| PubChem CID | 57225294 |
| Molecular Formula | C11H19ClO2 |
| Molecular Weight | 218.72 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | ethyl 9-chloronon-8-enoate |
| SMILES | CCOC(=O)CCCCCCC=CCl |
| InChI | InChI=1S/C11H19ClO2/c1-2-14-11(13)9-7-5-3-4-6-8-10-12/h8,10H,2-7,9H2,1H3 |
| InChIKey | WQBURIWZZATCFX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 9-chloronon-8-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 9-chloronon-8-enoate?
The IUPAC name of ethyl 9-chloronon-8-enoate (CID 57225294) is ethyl 9-chloronon-8-enoate.
What is the SMILES notation for ethyl 9-chloronon-8-enoate?
The canonical SMILES for ethyl 9-chloronon-8-enoate is CCOC(=O)CCCCCCC=CCl.
What is the InChIKey of ethyl 9-chloronon-8-enoate?
The InChIKey is WQBURIWZZATCFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19ClO2/c1-2-14-11(13)9-7-5-3-4-6-8-10-12/h8,10H,2-7,9H2,1H3.
What are the key properties of ethyl 9-chloronon-8-enoate?
ethyl 9-chloronon-8-enoate has a molecular weight of 218.72 g/mol, XLogP of 3.64, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 9-chloronon-8-enoate is sourced from PubChem (CID 57225294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).