C20H24O5S — CID 57225394
[(1S,8aS)-5-(benzenesulfonylmethyl)-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-1-yl] acetate (PubChem CID 57225394) has the molecular formula C20H24O5S and a molecular weight of 376.47 g/mol. Its IUPAC name is [(1S,8aS)-5-(benzenesulfonylmethyl)-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-1-yl] acetate.
| Compound Name | [(1S,8aS)-5-(benzenesulfonylmethyl)-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 57225394 |
| Molecular Formula | C20H24O5S |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [(1S,8aS)-5-(benzenesulfonylmethyl)-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCCC2=C(CS(=O)(=O)c3ccccc3)C(=O)CC[C@@]21C |
| InChI | InChI=1S/C20H24O5S/c1-14(21)25-19-10-6-9-17-16(18(22)11-12-20(17,19)2)13-26(23,24)15-7-4-3-5-8-15/h3-5,7-8,19H,6,9-13H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | NHNUJAIALDMFQS-PMACEKPBSA-N |
| XLogP | 3.24 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |