C11H17NO3 — CID 57225543
ethyl 6-carbamoyl-5-methylcyclohexene-1-carboxylate (PubChem CID 57225543) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is ethyl 6-carbamoyl-5-methylcyclohexene-1-carboxylate.
| Compound Name | ethyl 6-carbamoyl-5-methylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 57225543 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | ethyl 6-carbamoyl-5-methylcyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCC(C)C1C(N)=O |
| InChI | InChI=1S/C11H17NO3/c1-3-15-11(14)8-6-4-5-7(2)9(8)10(12)13/h6-7,9H,3-5H2,1-2H3,(H2,12,13) |
| InChIKey | QSSNCLXMEOEGCC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |