C11H18N2O5 — CID 572257
6-(pyridin-2-ylamino)hexane-1,2,3,4,5-pentol (PubChem CID 572257) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is 6-(pyridin-2-ylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | 6-(pyridin-2-ylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 572257 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 6-(pyridin-2-ylamino)hexane-1,2,3,4,5-pentol |
| SMILES | OCC(O)C(O)C(O)C(O)CNc1ccccn1 |
| InChI | InChI=1S/C11H18N2O5/c14-6-8(16)11(18)10(17)7(15)5-13-9-3-1-2-4-12-9/h1-4,7-8,10-11,14-18H,5-6H2,(H,12,13) |
| InChIKey | IUHVRPSJKJXYEK-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |