C16H15NO6S — CID 57226078
3-[N-(benzenesulfonyl)-2-hydroxyanilino]-4-oxobutanoic acid (PubChem CID 57226078) has the molecular formula C16H15NO6S and a molecular weight of 349.36 g/mol. Its IUPAC name is 3-[N-(benzenesulfonyl)-2-hydroxyanilino]-4-oxobutanoic acid.
| Compound Name | 3-[N-(benzenesulfonyl)-2-hydroxyanilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57226078 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 3-[N-(benzenesulfonyl)-2-hydroxyanilino]-4-oxobutanoic acid |
| SMILES | O=CC(CC(=O)O)N(c1ccccc1O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H15NO6S/c18-11-12(10-16(20)21)17(14-8-4-5-9-15(14)19)24(22,23)13-6-2-1-3-7-13/h1-9,11-12,19H,10H2,(H,20,21) |
| InChIKey | YRQOOUOSRCLCPR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|