C22H38O5 — CID 57226139
methyl 7-[(2R,3R,5S)-5-hydroxy-2-(8-hydroxyoct-1-enyl)-3-methoxycyclopentyl]hept-2-enoate (PubChem CID 57226139) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is methyl 7-[(2R,3R,5S)-5-hydroxy-2-(8-hydroxyoct-1-enyl)-3-methoxycyclopentyl]hept-2-enoate.
| Compound Name | methyl 7-[(2R,3R,5S)-5-hydroxy-2-(8-hydroxyoct-1-enyl)-3-methoxycyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 57226139 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | methyl 7-[(2R,3R,5S)-5-hydroxy-2-(8-hydroxyoct-1-enyl)-3-methoxycyclopentyl]hept-2-enoate |
| SMILES | COC(=O)C=CCCCCC1[C@@H](C=CCCCCCCO)[C@H](OC)C[C@@H]1O |
| InChI | InChI=1S/C22H38O5/c1-26-21-17-20(24)18(13-9-6-7-11-15-22(25)27-2)19(21)14-10-5-3-4-8-12-16-23/h10-11,14-15,18-21,23-24H,3-9,12-13,16-17H2,1-2H3/t18?,19-,20+,21-/m1/s1 |
| InChIKey | MXJDSCUOYLEPMU-OTYNDTSQSA-N |
| XLogP | 3.79 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|