C15H21NO8 — CID 57226218
methyl 2-[(2R,3R,4S,5R,6R)-2-(4-aminophenoxy)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetate (PubChem CID 57226218) has the molecular formula C15H21NO8 and a molecular weight of 343.33 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4S,5R,6R)-2-(4-aminophenoxy)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4S,5R,6R)-2-(4-aminophenoxy)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetate |
|---|---|
| PubChem CID | 57226218 |
| Molecular Formula | C15H21NO8 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | methyl 2-[(2R,3R,4S,5R,6R)-2-(4-aminophenoxy)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetate |
| SMILES | COC(=O)C[C@]1(O)[C@@H](Oc2ccc(N)cc2)O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H21NO8/c1-22-11(18)6-15(21)13(20)12(19)10(7-17)24-14(15)23-9-4-2-8(16)3-5-9/h2-5,10,12-14,17,19-21H,6-7,16H2,1H3/t10-,12+,13+,14+,15-/m1/s1 |
| InChIKey | ZNLXBGSRGGHYKO-QPGZIWCOSA-N |
| XLogP | -1.62 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|