C30H52O8 — CID 57226299
(2S,5S)-5-deuterio-2-[(1R,2R,3R,4S)-3-(2,3-dihydroxypropyl)-2-hydroxy-4-(oxan-2-yloxy)cyclopentyl]-6,6-dimethyl-5-(oxan-2-yl)-3-oxodecanal (PubChem CID 57226299) has the molecular formula C30H52O8 and a molecular weight of 541.74 g/mol. Its IUPAC name is (2S,5S)-5-deuterio-2-[(1R,2R,3R,4S)-3-(2,3-dihydroxypropyl)-2-hydroxy-4-(oxan-2-yloxy)cyclopentyl]-6,6-dimethyl-5-(oxan-2-yl)-3-oxodecanal.
| Compound Name | (2S,5S)-5-deuterio-2-[(1R,2R,3R,4S)-3-(2,3-dihydroxypropyl)-2-hydroxy-4-(oxan-2-yloxy)cyclopentyl]-6,6-dimethyl-5-(oxan-2-yl)-3-oxodecanal |
|---|---|
| PubChem CID | 57226299 |
| Molecular Formula | C30H52O8 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.37 |
| IUPAC Name | (2S,5S)-5-deuterio-2-[(1R,2R,3R,4S)-3-(2,3-dihydroxypropyl)-2-hydroxy-4-(oxan-2-yloxy)cyclopentyl]-6,6-dimethyl-5-(oxan-2-yl)-3-oxodecanal |
| SMILES | [2H][C@](CC(=O)[C@H](C=O)[C@H]1C[C@H](OC2CCCCO2)[C@H](CC(O)CO)[C@@H]1O)(C1CCCCO1)C(C)(C)CCCC |
| InChI | InChI=1S/C30H52O8/c1-4-5-12-30(2,3)24(26-10-6-8-13-36-26)17-25(34)23(19-32)21-16-27(38-28-11-7-9-14-37-28)22(29(21)35)15-20(33)18-31/h19-24,26-29,31,33,35H,4-18H2,1-3H3/t20?,21-,22+,23-,24+,26?,27+,28?,29-/m1/s1/i24D |
| InChIKey | FDAZSWCYPAXJGU-SUXXYIJASA-N |
| XLogP | 3.81 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|