C11H17BrN4O2 — CID 57226473
1-N'-[(6-bromo-3-pyridinyl)methyl]-1-N,1-N,1-N'-trimethyl-2-nitroethane-1,1-diamine (PubChem CID 57226473) has the molecular formula C11H17BrN4O2 and a molecular weight of 317.19 g/mol. Its IUPAC name is 1-N'-[(6-bromo-3-pyridinyl)methyl]-1-N,1-N,1-N'-trimethyl-2-nitroethane-1,1-diamine.
| Compound Name | 1-N'-[(6-bromo-3-pyridinyl)methyl]-1-N,1-N,1-N'-trimethyl-2-nitroethane-1,1-diamine |
|---|---|
| PubChem CID | 57226473 |
| Molecular Formula | C11H17BrN4O2 |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 1-N'-[(6-bromo-3-pyridinyl)methyl]-1-N,1-N,1-N'-trimethyl-2-nitroethane-1,1-diamine |
| SMILES | CN(C)C(C[N+](=O)[O-])N(C)Cc1ccc(Br)nc1 |
| InChI | InChI=1S/C11H17BrN4O2/c1-14(2)11(8-16(17)18)15(3)7-9-4-5-10(12)13-6-9/h4-6,11H,7-8H2,1-3H3 |
| InChIKey | ILJQJFKHQCCTEO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|