C16H10ClN3O3S — CID 57226618
3-(6-chloro-2-pyridinyl)-5-methyl-[1,3]oxazino[5,6-c][1,2]benzothiazine-2,4-dione (PubChem CID 57226618) has the molecular formula C16H10ClN3O3S and a molecular weight of 359.79 g/mol. Its IUPAC name is 3-(6-chloro-2-pyridinyl)-5-methyl-[1,3]oxazino[5,6-c][1,2]benzothiazine-2,4-dione.
| Compound Name | 3-(6-chloro-2-pyridinyl)-5-methyl-[1,3]oxazino[5,6-c][1,2]benzothiazine-2,4-dione |
|---|---|
| PubChem CID | 57226618 |
| Molecular Formula | C16H10ClN3O3S |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 3-(6-chloro-2-pyridinyl)-5-methyl-[1,3]oxazino[5,6-c][1,2]benzothiazine-2,4-dione |
| SMILES | CN1Sc2ccccc2-c2oc(=O)n(-c3cccc(Cl)n3)c(=O)c21 |
| InChI | InChI=1S/C16H10ClN3O3S/c1-19-13-14(9-5-2-3-6-10(9)24-19)23-16(22)20(15(13)21)12-8-4-7-11(17)18-12/h2-8H,1H3 |
| InChIKey | MZAWKYKNFZNMOA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|