About 6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine
6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine (PubChem CID 57226826) has the molecular formula C13H29FN2
and a molecular weight of 232.39 g/mol. Its IUPAC name is 6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine.
Molecular Properties
| Compound Name | 6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine |
| PubChem CID | 57226826 |
| Molecular Formula | C13H29FN2 |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.23 |
| IUPAC Name | 6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine |
| SMILES | CCC(CCC(C)C(C)NF)N(CC)CC |
| InChI | InChI=1S/C13H29FN2/c1-6-13(16(7-2)8-3)10-9-11(4)12(5)15-14/h11-13,15H,6-10H2,1-5H3 |
| InChIKey | AJWUMVPXWNNESR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine?
The IUPAC name of 6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine (CID 57226826) is 6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine.
What is the SMILES notation for 6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine?
The canonical SMILES for 6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine is CCC(CCC(C)C(C)NF)N(CC)CC.
What is the InChIKey of 6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine?
The InChIKey is AJWUMVPXWNNESR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29FN2/c1-6-13(16(7-2)8-3)10-9-11(4)12(5)15-14/h11-13,15H,6-10H2,1-5H3.
What are the key properties of 6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine?
6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine has a molecular weight of 232.39 g/mol, XLogP of 3.39, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N,6-N-diethyl-2-N-fluoro-3-methyloctane-2,6-diamine is sourced from PubChem (CID 57226826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).