About 1-(2-ethoxyethoxy)-1,3-difluoropropane
1-(2-ethoxyethoxy)-1,3-difluoropropane (PubChem CID 57226963) has the molecular formula C7H14F2O2
and a molecular weight of 168.18 g/mol. Its IUPAC name is 1-(2-ethoxyethoxy)-1,3-difluoropropane.
Molecular Properties
| Compound Name | 1-(2-ethoxyethoxy)-1,3-difluoropropane |
| PubChem CID | 57226963 |
| Molecular Formula | C7H14F2O2 |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 1-(2-ethoxyethoxy)-1,3-difluoropropane |
| SMILES | CCOCCOC(F)CCF |
| InChI | InChI=1S/C7H14F2O2/c1-2-10-5-6-11-7(9)3-4-8/h7H,2-6H2,1H3 |
| InChIKey | CZRXFQLUNJPXTH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-ethoxyethoxy)-1,3-difluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethoxyethoxy)-1,3-difluoropropane?
The IUPAC name of 1-(2-ethoxyethoxy)-1,3-difluoropropane (CID 57226963) is 1-(2-ethoxyethoxy)-1,3-difluoropropane.
What is the SMILES notation for 1-(2-ethoxyethoxy)-1,3-difluoropropane?
The canonical SMILES for 1-(2-ethoxyethoxy)-1,3-difluoropropane is CCOCCOC(F)CCF.
What is the InChIKey of 1-(2-ethoxyethoxy)-1,3-difluoropropane?
The InChIKey is CZRXFQLUNJPXTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F2O2/c1-2-10-5-6-11-7(9)3-4-8/h7H,2-6H2,1H3.
What are the key properties of 1-(2-ethoxyethoxy)-1,3-difluoropropane?
1-(2-ethoxyethoxy)-1,3-difluoropropane has a molecular weight of 168.18 g/mol, XLogP of 1.69, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethoxyethoxy)-1,3-difluoropropane is sourced from PubChem (CID 57226963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).