C29H34F6N2O2 — CID 57227065
(3aS,3bS,9aS,9bR,11aS)-N-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide (PubChem CID 57227065) has the molecular formula C29H34F6N2O2 and a molecular weight of 556.59 g/mol. Its IUPAC name is (3aS,3bS,9aS,9bR,11aS)-N-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide.
| Compound Name | (3aS,3bS,9aS,9bR,11aS)-N-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 57227065 |
| Molecular Formula | C29H34F6N2O2 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | (3aS,3bS,9aS,9bR,11aS)-N-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide |
| SMILES | CN1C(=O)C(C(=O)NC(c2ccccc2)(C(F)(F)F)C(F)(F)F)=C[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C29H34F6N2O2/c1-25-14-7-10-20(25)18-11-12-22-26(2,21(18)13-15-25)16-19(24(39)37(22)3)23(38)36-27(28(30,31)32,29(33,34)35)17-8-5-4-6-9-17/h4-6,8-9,16,18,20-22H,7,10-15H2,1-3H3,(H,36,38)/t18-,20-,21+,22?,25-,26+/m0/s1 |
| InChIKey | HUQSEIFVINBNCN-CWGGTNISSA-N |
| XLogP | 6.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|