C19H24O7 — CID 57227180
(2S,3R,4R,5S,6R)-6-(hydroxymethyl)-2-naphthalen-1-yl-5-propan-2-yloxyoxane-2,3,4,5-tetrol (PubChem CID 57227180) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-2-naphthalen-1-yl-5-propan-2-yloxyoxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-2-naphthalen-1-yl-5-propan-2-yloxyoxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 57227180 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-2-naphthalen-1-yl-5-propan-2-yloxyoxane-2,3,4,5-tetrol |
| SMILES | CC(C)O[C@@]1(O)[C@H](O)[C@@H](O)[C@](O)(c2cccc3ccccc23)O[C@@H]1CO |
| InChI | InChI=1S/C19H24O7/c1-11(2)25-19(24)15(10-20)26-18(23,16(21)17(19)22)14-9-5-7-12-6-3-4-8-13(12)14/h3-9,11,15-17,20-24H,10H2,1-2H3/t15-,16-,17-,18+,19-/m1/s1 |
| InChIKey | RBJSYXLSVGTCBB-IEWDOMPSSA-N |
| XLogP | 0.21 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|