C13H10F2NO3S- — CID 57227288
2,4-difluoro-1-[[2-(sulfinatoamino)phenyl]methoxy]benzene (PubChem CID 57227288) has the molecular formula C13H10F2NO3S- and a molecular weight of 298.29 g/mol. Its IUPAC name is 2,4-difluoro-1-[[2-(sulfinatoamino)phenyl]methoxy]benzene.
| Compound Name | 2,4-difluoro-1-[[2-(sulfinatoamino)phenyl]methoxy]benzene |
|---|---|
| PubChem CID | 57227288 |
| Molecular Formula | C13H10F2NO3S- |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2,4-difluoro-1-[[2-(sulfinatoamino)phenyl]methoxy]benzene |
| SMILES | O=S([O-])Nc1ccccc1COc1ccc(F)cc1F |
| InChI | InChI=1S/C13H11F2NO3S/c14-10-5-6-13(11(15)7-10)19-8-9-3-1-2-4-12(9)16-20(17)18/h1-7,16H,8H2,(H,17,18)/p-1 |
| InChIKey | XIIQHFUEIFWYOL-UHFFFAOYSA-M |
| XLogP | 2.75 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|