About 2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine
2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine (PubChem CID 57227310) has the molecular formula C12H9F3N2
and a molecular weight of 238.21 g/mol. Its IUPAC name is 2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine.
Molecular Properties
| Compound Name | 2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine |
| PubChem CID | 57227310 |
| Molecular Formula | C12H9F3N2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine |
| SMILES | Cc1cc(-c2cc(F)c(F)c(F)c2)nc(C)n1 |
| InChI | InChI=1S/C12H9F3N2/c1-6-3-11(17-7(2)16-6)8-4-9(13)12(15)10(14)5-8/h3-5H,1-2H3 |
| InChIKey | IQGFGUFKHDYVEC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine?
The IUPAC name of 2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine (CID 57227310) is 2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine.
What is the SMILES notation for 2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine?
The canonical SMILES for 2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine is Cc1cc(-c2cc(F)c(F)c(F)c2)nc(C)n1.
What is the InChIKey of 2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine?
The InChIKey is IQGFGUFKHDYVEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F3N2/c1-6-3-11(17-7(2)16-6)8-4-9(13)12(15)10(14)5-8/h3-5H,1-2H3.
What are the key properties of 2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine?
2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine has a molecular weight of 238.21 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-6-(3,4,5-trifluorophenyl)pyrimidine is sourced from PubChem (CID 57227310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).