C29H58O2Si2 — CID 57227346
[6a-[3-[tert-butyl(dimethyl)silyl]oxy-3-methyloct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 57227346) has the molecular formula C29H58O2Si2 and a molecular weight of 494.95 g/mol. Its IUPAC name is [6a-[3-[tert-butyl(dimethyl)silyl]oxy-3-methyloct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [6a-[3-[tert-butyl(dimethyl)silyl]oxy-3-methyloct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 57227346 |
| Molecular Formula | C29H58O2Si2 |
| Molecular Weight | 494.95 g/mol |
| Exact Mass | 494.40 |
| IUPAC Name | [6a-[3-[tert-butyl(dimethyl)silyl]oxy-3-methyloct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCCCC(C)(C=CC12CCCC1CC(O[Si](C)(C)C(C)(C)C)C2)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H58O2Si2/c1-13-14-15-18-28(8,31-33(11,12)27(5,6)7)20-21-29-19-16-17-24(29)22-25(23-29)30-32(9,10)26(2,3)4/h20-21,24-25H,13-19,22-23H2,1-12H3 |
| InChIKey | UWUCGUBWMMZFPC-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.95 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|