About 1,2,4-thiadiazol-3-yl acetate
1,2,4-thiadiazol-3-yl acetate (PubChem CID 57227910) has the molecular formula C4H4N2O2S
and a molecular weight of 144.16 g/mol. Its IUPAC name is 1,2,4-thiadiazol-3-yl acetate.
Molecular Properties
| Compound Name | 1,2,4-thiadiazol-3-yl acetate |
| PubChem CID | 57227910 |
| Molecular Formula | C4H4N2O2S |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.00 |
| IUPAC Name | 1,2,4-thiadiazol-3-yl acetate |
| SMILES | CC(=O)Oc1ncsn1 |
| InChI | InChI=1S/C4H4N2O2S/c1-3(7)8-4-5-2-9-6-4/h2H,1H3 |
| InChIKey | UUCMPLCGPAYIFC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,2,4-thiadiazol-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-thiadiazol-3-yl acetate?
The IUPAC name of 1,2,4-thiadiazol-3-yl acetate (CID 57227910) is 1,2,4-thiadiazol-3-yl acetate.
What is the SMILES notation for 1,2,4-thiadiazol-3-yl acetate?
The canonical SMILES for 1,2,4-thiadiazol-3-yl acetate is CC(=O)Oc1ncsn1.
What is the InChIKey of 1,2,4-thiadiazol-3-yl acetate?
The InChIKey is UUCMPLCGPAYIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2S/c1-3(7)8-4-5-2-9-6-4/h2H,1H3.
What are the key properties of 1,2,4-thiadiazol-3-yl acetate?
1,2,4-thiadiazol-3-yl acetate has a molecular weight of 144.16 g/mol, XLogP of 0.46, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-thiadiazol-3-yl acetate is sourced from PubChem (CID 57227910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).