About 2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol
2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol (PubChem CID 57228343) has the molecular formula C17H21ClN4O2
and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol.
Molecular Properties
| Compound Name | 2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol |
| PubChem CID | 57228343 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol |
| SMILES | Nc1ncc(Oc2ccc(Cl)cc2)c(N[C@@H]2CC[C@H](CCO)C2)n1 |
| InChI | InChI=1S/C17H21ClN4O2/c18-12-2-5-14(6-3-12)24-15-10-20-17(19)22-16(15)21-13-4-1-11(9-13)7-8-23/h2-3,5-6,10-11,13,23H,1,4,7-9H2,(H3,19,20,21,22)/t11-,13-/m1/s1 |
| InChIKey | RLBDHOOKZSUTDK-DGCLKSJQSA-N |
| XLogP | 3.47 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol?
The IUPAC name of 2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol (CID 57228343) is 2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol.
What is the SMILES notation for 2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol?
The canonical SMILES for 2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol is Nc1ncc(Oc2ccc(Cl)cc2)c(N[C@@H]2CC[C@H](CCO)C2)n1.
What is the InChIKey of 2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol?
The InChIKey is RLBDHOOKZSUTDK-DGCLKSJQSA-N. The full InChI is InChI=1S/C17H21ClN4O2/c18-12-2-5-14(6-3-12)24-15-10-20-17(19)22-16(15)21-13-4-1-11(9-13)7-8-23/h2-3,5-6,10-11,13,23H,1,4,7-9H2,(H3,19,20,21,22)/t11-,13-/m1/s1.
What are the key properties of 2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol?
2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol has a molecular weight of 348.83 g/mol, XLogP of 3.47, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,3R)-3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclopentyl]ethanol is sourced from PubChem (CID 57228343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).