C12H13NO3S2 — CID 57228358
4-[(2S,3S,4R,5S)-3,4,5-trihydroxythian-2-yl]sulfanylbenzonitrile (PubChem CID 57228358) has the molecular formula C12H13NO3S2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-[(2S,3S,4R,5S)-3,4,5-trihydroxythian-2-yl]sulfanylbenzonitrile.
| Compound Name | 4-[(2S,3S,4R,5S)-3,4,5-trihydroxythian-2-yl]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 57228358 |
| Molecular Formula | C12H13NO3S2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 4-[(2S,3S,4R,5S)-3,4,5-trihydroxythian-2-yl]sulfanylbenzonitrile |
| SMILES | N#Cc1ccc(S[C@@H]2SC[C@@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C12H13NO3S2/c13-5-7-1-3-8(4-2-7)18-12-11(16)10(15)9(14)6-17-12/h1-4,9-12,14-16H,6H2/t9-,10-,11+,12+/m1/s1 |
| InChIKey | LVFZTPIRDLQIGF-WYUUTHIRSA-N |
| XLogP | 0.81 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |