About 3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine
3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine (PubChem CID 57228441) has the molecular formula C21H24ClN3S
and a molecular weight of 385.96 g/mol. Its IUPAC name is 3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine.
Molecular Properties
| Compound Name | 3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine |
| PubChem CID | 57228441 |
| Molecular Formula | C21H24ClN3S |
| Molecular Weight | 385.96 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine |
| SMILES | CSc1ccc(CC(c2ccnc3cc(Cl)ccc23)C(C)(N)CN)cc1 |
| InChI | InChI=1S/C21H24ClN3S/c1-21(24,13-23)19(11-14-3-6-16(26-2)7-4-14)17-9-10-25-20-12-15(22)5-8-18(17)20/h3-10,12,19H,11,13,23-24H2,1-2H3 |
| InChIKey | BVFCHEHOGKBEIC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.96 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine?
The IUPAC name of 3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine (CID 57228441) is 3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine.
What is the SMILES notation for 3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine?
The canonical SMILES for 3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine is CSc1ccc(CC(c2ccnc3cc(Cl)ccc23)C(C)(N)CN)cc1.
What is the InChIKey of 3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine?
The InChIKey is BVFCHEHOGKBEIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24ClN3S/c1-21(24,13-23)19(11-14-3-6-16(26-2)7-4-14)17-9-10-25-20-12-15(22)5-8-18(17)20/h3-10,12,19H,11,13,23-24H2,1-2H3.
What are the key properties of 3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine?
3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine has a molecular weight of 385.96 g/mol, XLogP of 4.61, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-chloroquinolin-4-yl)-2-methyl-4-(4-methylsulfanylphenyl)butane-1,2-diamine is sourced from PubChem (CID 57228441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).