C14H23F3 — CID 57228493
1-methyl-4-(1,1,1-trifluoroheptan-4-yl)cyclohexene (PubChem CID 57228493) has the molecular formula C14H23F3 and a molecular weight of 248.33 g/mol. Its IUPAC name is 1-methyl-4-(1,1,1-trifluoroheptan-4-yl)cyclohexene.
| Compound Name | 1-methyl-4-(1,1,1-trifluoroheptan-4-yl)cyclohexene |
|---|---|
| PubChem CID | 57228493 |
| Molecular Formula | C14H23F3 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1-methyl-4-(1,1,1-trifluoroheptan-4-yl)cyclohexene |
| SMILES | CCCC(CCC(F)(F)F)C1CC=C(C)CC1 |
| InChI | InChI=1S/C14H23F3/c1-3-4-12(9-10-14(15,16)17)13-7-5-11(2)6-8-13/h5,12-13H,3-4,6-10H2,1-2H3 |
| InChIKey | QFTPISWUAPKSKF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|