About 4-acetyliminobutanamide
4-acetyliminobutanamide (PubChem CID 57228696) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 4-acetyliminobutanamide.
Molecular Properties
| Compound Name | 4-acetyliminobutanamide |
| PubChem CID | 57228696 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 4-acetyliminobutanamide |
| SMILES | CC(=O)/N=C/CCC(N)=O |
| InChI | InChI=1S/C6H10N2O2/c1-5(9)8-4-2-3-6(7)10/h4H,2-3H2,1H3,(H2,7,10)/b8-4+ |
| InChIKey | KNWDOIJFEUIXEF-XBXARRHUSA-N |
| XLogP | -0.13 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyliminobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyliminobutanamide?
The IUPAC name of 4-acetyliminobutanamide (CID 57228696) is 4-acetyliminobutanamide.
What is the SMILES notation for 4-acetyliminobutanamide?
The canonical SMILES for 4-acetyliminobutanamide is CC(=O)/N=C/CCC(N)=O.
What is the InChIKey of 4-acetyliminobutanamide?
The InChIKey is KNWDOIJFEUIXEF-XBXARRHUSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-5(9)8-4-2-3-6(7)10/h4H,2-3H2,1H3,(H2,7,10)/b8-4+.
What are the key properties of 4-acetyliminobutanamide?
4-acetyliminobutanamide has a molecular weight of 142.16 g/mol, XLogP of -0.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyliminobutanamide is sourced from PubChem (CID 57228696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).