C27H22Cl3F3N4O6S2 — CID 57228829
3-methyl-5-[2,2,2-trichloro-1-(2-methylsulfonyl-N-(2-methylsulfonylphenyl)anilino)ethyl]imino-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 57228829) has the molecular formula C27H22Cl3F3N4O6S2 and a molecular weight of 725.98 g/mol. Its IUPAC name is 3-methyl-5-[2,2,2-trichloro-1-(2-methylsulfonyl-N-(2-methylsulfonylphenyl)anilino)ethyl]imino-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-methyl-5-[2,2,2-trichloro-1-(2-methylsulfonyl-N-(2-methylsulfonylphenyl)anilino)ethyl]imino-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 57228829 |
| Molecular Formula | C27H22Cl3F3N4O6S2 |
| Molecular Weight | 725.98 g/mol |
| Exact Mass | 724.00 |
| IUPAC Name | 3-methyl-5-[2,2,2-trichloro-1-(2-methylsulfonyl-N-(2-methylsulfonylphenyl)anilino)ethyl]imino-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(=NC(N(c2ccccc2S(C)(=O)=O)c2ccccc2S(C)(=O)=O)C(Cl)(Cl)Cl)N(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C27H22Cl3F3N4O6S2/c1-35-23(38)22(36(25(35)39)17-10-8-9-16(15-17)27(31,32)33)34-24(26(28,29)30)37(18-11-4-6-13-20(18)44(2,40)41)19-12-5-7-14-21(19)45(3,42)43/h4-15,24H,1-3H3 |
| InChIKey | STKDWNYRDIWBCF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 124.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.98 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|