C11H17N3 — CID 57229215
N,N-dimethyl-4-(1,2,3,6-tetrahydropyridin-6-yl)-1H-pyrrol-2-amine (PubChem CID 57229215) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N,N-dimethyl-4-(1,2,3,6-tetrahydropyridin-6-yl)-1H-pyrrol-2-amine.
| Compound Name | N,N-dimethyl-4-(1,2,3,6-tetrahydropyridin-6-yl)-1H-pyrrol-2-amine |
|---|---|
| PubChem CID | 57229215 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N,N-dimethyl-4-(1,2,3,6-tetrahydropyridin-6-yl)-1H-pyrrol-2-amine |
| SMILES | CN(C)c1cc(C2C=CCCN2)c[nH]1 |
| InChI | InChI=1S/C11H17N3/c1-14(2)11-7-9(8-13-11)10-5-3-4-6-12-10/h3,5,7-8,10,12-13H,4,6H2,1-2H3 |
| InChIKey | OXQZWCVVUGUDRO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|