About N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide
N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 57229378) has the molecular formula C7H8N2O2S2
and a molecular weight of 216.29 g/mol. Its IUPAC name is N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 57229378 |
| Molecular Formula | C7H8N2O2S2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(C(=O)CS)s1 |
| InChI | InChI=1S/C7H8N2O2S2/c1-4(10)9-7-8-2-6(13-7)5(11)3-12/h2,12H,3H2,1H3,(H,8,9,10) |
| InChIKey | KNEZQUCAMHYHPF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide (CID 57229378) is N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1ncc(C(=O)CS)s1.
What is the InChIKey of N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is KNEZQUCAMHYHPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S2/c1-4(10)9-7-8-2-6(13-7)5(11)3-12/h2,12H,3H2,1H3,(H,8,9,10).
What are the key properties of N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide?
N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 216.29 g/mol, XLogP of 1.21, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2-sulfanylacetyl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 57229378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).