C18H13Cl3F2N4O2 — CID 57229756
1-(2-fluorophenyl)-3-methyl-5-[2,2,2-trichloro-1-(4-fluoroanilino)ethyl]iminoimidazolidine-2,4-dione (PubChem CID 57229756) has the molecular formula C18H13Cl3F2N4O2 and a molecular weight of 461.68 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-methyl-5-[2,2,2-trichloro-1-(4-fluoroanilino)ethyl]iminoimidazolidine-2,4-dione.
| Compound Name | 1-(2-fluorophenyl)-3-methyl-5-[2,2,2-trichloro-1-(4-fluoroanilino)ethyl]iminoimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 57229756 |
| Molecular Formula | C18H13Cl3F2N4O2 |
| Molecular Weight | 461.68 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 1-(2-fluorophenyl)-3-methyl-5-[2,2,2-trichloro-1-(4-fluoroanilino)ethyl]iminoimidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(=NC(Nc2ccc(F)cc2)C(Cl)(Cl)Cl)N(c2ccccc2F)C1=O |
| InChI | InChI=1S/C18H13Cl3F2N4O2/c1-26-15(28)14(27(17(26)29)13-5-3-2-4-12(13)23)25-16(18(19,20)21)24-11-8-6-10(22)7-9-11/h2-9,16,24H,1H3 |
| InChIKey | REPANLVLRARRHH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.68 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|