About methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate
methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate (PubChem CID 57229891) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate.
Molecular Properties
| Compound Name | methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate |
| PubChem CID | 57229891 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate |
| SMILES | COC(=O)C(C)=CC(O)CC(C)CCO |
| InChI | InChI=1S/C11H20O4/c1-8(4-5-12)6-10(13)7-9(2)11(14)15-3/h7-8,10,12-13H,4-6H2,1-3H3 |
| InChIKey | WFPTXQJDBVGRDE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate?
The IUPAC name of methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate (CID 57229891) is methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate.
What is the SMILES notation for methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate?
The canonical SMILES for methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate is COC(=O)C(C)=CC(O)CC(C)CCO.
What is the InChIKey of methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate?
The InChIKey is WFPTXQJDBVGRDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-8(4-5-12)6-10(13)7-9(2)11(14)15-3/h7-8,10,12-13H,4-6H2,1-3H3.
What are the key properties of methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate?
methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate has a molecular weight of 216.28 g/mol, XLogP of 0.88, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,8-dihydroxy-2,6-dimethyloct-2-enoate is sourced from PubChem (CID 57229891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).