About 3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite
3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite (PubChem CID 57229933) has the molecular formula C19H26O3S
and a molecular weight of 334.48 g/mol. Its IUPAC name is 3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite.
Molecular Properties
| Compound Name | 3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite |
| PubChem CID | 57229933 |
| Molecular Formula | C19H26O3S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite |
| SMILES | CC(C)Cc1ccc(OS(=O)OCC#CC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H26O3S/c1-16(2)15-18-10-12-19(13-11-18)22-23(20)21-14-6-9-17-7-4-3-5-8-17/h10-13,16-17H,3-5,7-8,14-15H2,1-2H3 |
| InChIKey | HAYMTIMOXBIDNW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite?
The IUPAC name of 3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite (CID 57229933) is 3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite.
What is the SMILES notation for 3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite?
The canonical SMILES for 3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite is CC(C)Cc1ccc(OS(=O)OCC#CC2CCCCC2)cc1.
What is the InChIKey of 3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite?
The InChIKey is HAYMTIMOXBIDNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O3S/c1-16(2)15-18-10-12-19(13-11-18)22-23(20)21-14-6-9-17-7-4-3-5-8-17/h10-13,16-17H,3-5,7-8,14-15H2,1-2H3.
What are the key properties of 3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite?
3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite has a molecular weight of 334.48 g/mol, XLogP of 4.44, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylprop-2-ynyl [4-(2-methylpropyl)phenyl] sulfite is sourced from PubChem (CID 57229933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).