2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid

C11H18O6 — CID 57230487

IUPAC2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid
SMILESCC(C)C1OCC(CC(C(=O)O)C(=O)O)CO1
InChIInChI=1S/C11H18O6/c1-6(2)11-16-4-7(5-17-11)3-8(9(12)13)10(14)15/h6-8,11H,3-5H2,1-2H3,(H,12,13)(H,14,15)
InChIKeyBTGJRKCNQUZXGX-UHFFFAOYSA-N
MW246.26 g/mol
LogP0.81
Rot. Bonds5

About 2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid

2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid (PubChem CID 57230487) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid.

Molecular Properties

Compound Name2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid
PubChem CID57230487
Molecular FormulaC11H18O6
Molecular Weight246.26 g/mol
Exact Mass246.11
IUPAC Name2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid
SMILESCC(C)C1OCC(CC(C(=O)O)C(=O)O)CO1
InChIInChI=1S/C11H18O6/c1-6(2)11-16-4-7(5-17-11)3-8(9(12)13)10(14)15/h6-8,11H,3-5H2,1-2H3,(H,12,13)(H,14,15)
InChIKeyBTGJRKCNQUZXGX-UHFFFAOYSA-N
XLogP0.81
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.26
LogP ≤ 50.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid?
The IUPAC name of 2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid (CID 57230487) is 2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid.
What is the SMILES notation for 2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid?
The canonical SMILES for 2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid is CC(C)C1OCC(CC(C(=O)O)C(=O)O)CO1.
What is the InChIKey of 2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid?
The InChIKey is BTGJRKCNQUZXGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O6/c1-6(2)11-16-4-7(5-17-11)3-8(9(12)13)10(14)15/h6-8,11H,3-5H2,1-2H3,(H,12,13)(H,14,15).
What are the key properties of 2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid?
2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid has a molecular weight of 246.26 g/mol, XLogP of 0.81, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-propan-2-yl-1,3-dioxan-5-yl)methyl]propanedioic acid is sourced from PubChem (CID 57230487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).