About butyl 6-formyloxyhexanoate
butyl 6-formyloxyhexanoate (PubChem CID 57230567) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is butyl 6-formyloxyhexanoate.
Molecular Properties
| Compound Name | butyl 6-formyloxyhexanoate |
| PubChem CID | 57230567 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | butyl 6-formyloxyhexanoate |
| SMILES | CCCCOC(=O)CCCCCOC=O |
| InChI | InChI=1S/C11H20O4/c1-2-3-9-15-11(13)7-5-4-6-8-14-10-12/h10H,2-9H2,1H3 |
| InChIKey | VZHACYGJCGAEKK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 6-formyloxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 6-formyloxyhexanoate?
The IUPAC name of butyl 6-formyloxyhexanoate (CID 57230567) is butyl 6-formyloxyhexanoate.
What is the SMILES notation for butyl 6-formyloxyhexanoate?
The canonical SMILES for butyl 6-formyloxyhexanoate is CCCCOC(=O)CCCCCOC=O.
What is the InChIKey of butyl 6-formyloxyhexanoate?
The InChIKey is VZHACYGJCGAEKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-2-3-9-15-11(13)7-5-4-6-8-14-10-12/h10H,2-9H2,1H3.
What are the key properties of butyl 6-formyloxyhexanoate?
butyl 6-formyloxyhexanoate has a molecular weight of 216.28 g/mol, XLogP of 2.06, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 6-formyloxyhexanoate is sourced from PubChem (CID 57230567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).