About [4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate
[4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate (PubChem CID 57230659) has the molecular formula C35H30N2O4S2
and a molecular weight of 606.77 g/mol. Its IUPAC name is [4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate.
Molecular Properties
| Compound Name | [4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate |
| PubChem CID | 57230659 |
| Molecular Formula | C35H30N2O4S2 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | [4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate |
| SMILES | O=COC1CCC(c2ccc(OCc3nc4ccccc4s3)cc2)(c2ccc(OCc3nc4ccccc4s3)cc2)CC1 |
| InChI | InChI=1S/C35H30N2O4S2/c38-23-41-28-17-19-35(20-18-28,24-9-13-26(14-10-24)39-21-33-36-29-5-1-3-7-31(29)42-33)25-11-15-27(16-12-25)40-22-34-37-30-6-2-4-8-32(30)43-34/h1-16,23,28H,17-22H2 |
| InChIKey | PZRDOXLBZLYMDZ-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate?
The IUPAC name of [4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate (CID 57230659) is [4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate.
What is the SMILES notation for [4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate?
The canonical SMILES for [4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate is O=COC1CCC(c2ccc(OCc3nc4ccccc4s3)cc2)(c2ccc(OCc3nc4ccccc4s3)cc2)CC1.
What is the InChIKey of [4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate?
The InChIKey is PZRDOXLBZLYMDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H30N2O4S2/c38-23-41-28-17-19-35(20-18-28,24-9-13-26(14-10-24)39-21-33-36-29-5-1-3-7-31(29)42-33)25-11-15-27(16-12-25)40-22-34-37-30-6-2-4-8-32(30)43-34/h1-16,23,28H,17-22H2.
What are the key properties of [4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate?
[4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate has a molecular weight of 606.77 g/mol, XLogP of 8.47, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-bis[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]cyclohexyl] formate is sourced from PubChem (CID 57230659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).