C20H19N3O3S2 — CID 57230682
3-[5-[3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 57230682) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-[5-[3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[5-[3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 57230682 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 3-[5-[3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C=CC=C1SC(=S)N(CCC(=O)O)C1=O |
| InChI | InChI=1S/C20H19N3O3S2/c1-13-16(14(2)23(21-13)15-7-4-3-5-8-15)9-6-10-17-19(26)22(20(27)28-17)12-11-18(24)25/h3-10H,11-12H2,1-2H3,(H,24,25) |
| InChIKey | REUDWAGQVNLPSY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|