C17H32N2O5 — CID 57230850
(2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hexanoyl]amino]-3,3-dimethylbutanoic acid (PubChem CID 57230850) has the molecular formula C17H32N2O5 and a molecular weight of 344.45 g/mol. Its IUPAC name is (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hexanoyl]amino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hexanoyl]amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 57230850 |
| Molecular Formula | C17H32N2O5 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hexanoyl]amino]-3,3-dimethylbutanoic acid |
| SMILES | CCC[C@H](C(=O)NO)[C@@H](CC(C)C)C(=O)N[C@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C17H32N2O5/c1-7-8-11(15(21)19-24)12(9-10(2)3)14(20)18-13(16(22)23)17(4,5)6/h10-13,24H,7-9H2,1-6H3,(H,18,20)(H,19,21)(H,22,23)/t11-,12+,13+/m0/s1 |
| InChIKey | YMMTYKUFDOHVCV-YNEHKIRRSA-N |
| XLogP | 2.19 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|