C12H15FO2 — CID 57230984
(5R)-8-fluoro-2,2,4-trimethyl-5,6-dihydrochromen-5-ol (PubChem CID 57230984) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is (5R)-8-fluoro-2,2,4-trimethyl-5,6-dihydrochromen-5-ol.
| Compound Name | (5R)-8-fluoro-2,2,4-trimethyl-5,6-dihydrochromen-5-ol |
|---|---|
| PubChem CID | 57230984 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (5R)-8-fluoro-2,2,4-trimethyl-5,6-dihydrochromen-5-ol |
| SMILES | CC1=CC(C)(C)OC2=C1[C@H](O)CC=C2F |
| InChI | InChI=1S/C12H15FO2/c1-7-6-12(2,3)15-11-8(13)4-5-9(14)10(7)11/h4,6,9,14H,5H2,1-3H3/t9-/m1/s1 |
| InChIKey | QPPMQAOAPZUZAX-SECBINFHSA-N |
| XLogP | 2.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |