C19H34O3 — CID 57231387
(3S,4S,5S,8S)-5-methyl-8-non-1-enyl-4-propoxy-1,7-dioxaspiro[2.5]octane (PubChem CID 57231387) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (3S,4S,5S,8S)-5-methyl-8-non-1-enyl-4-propoxy-1,7-dioxaspiro[2.5]octane.
| Compound Name | (3S,4S,5S,8S)-5-methyl-8-non-1-enyl-4-propoxy-1,7-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 57231387 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (3S,4S,5S,8S)-5-methyl-8-non-1-enyl-4-propoxy-1,7-dioxaspiro[2.5]octane |
| SMILES | CCCCCCCC=C[C@@H]1OC[C@H](C)[C@H](OCCC)[C@]12CO2 |
| InChI | InChI=1S/C19H34O3/c1-4-6-7-8-9-10-11-12-17-19(15-22-19)18(20-13-5-2)16(3)14-21-17/h11-12,16-18H,4-10,13-15H2,1-3H3/t16-,17-,18-,19-/m0/s1 |
| InChIKey | YUDYAMVQGSGXSG-VJANTYMQSA-N |
| XLogP | 4.50 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|