About 2,8-dimethylnonane-3,7-dithiol
2,8-dimethylnonane-3,7-dithiol (PubChem CID 57231773) has the molecular formula C11H24S2
and a molecular weight of 220.45 g/mol. Its IUPAC name is 2,8-dimethylnonane-3,7-dithiol.
Molecular Properties
| Compound Name | 2,8-dimethylnonane-3,7-dithiol |
| PubChem CID | 57231773 |
| Molecular Formula | C11H24S2 |
| Molecular Weight | 220.45 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2,8-dimethylnonane-3,7-dithiol |
| SMILES | CC(C)C(S)CCCC(S)C(C)C |
| InChI | InChI=1S/C11H24S2/c1-8(2)10(12)6-5-7-11(13)9(3)4/h8-13H,5-7H2,1-4H3 |
| InChIKey | RLOMJCJXMCAJCR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,8-dimethylnonane-3,7-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dimethylnonane-3,7-dithiol?
The IUPAC name of 2,8-dimethylnonane-3,7-dithiol (CID 57231773) is 2,8-dimethylnonane-3,7-dithiol.
What is the SMILES notation for 2,8-dimethylnonane-3,7-dithiol?
The canonical SMILES for 2,8-dimethylnonane-3,7-dithiol is CC(C)C(S)CCCC(S)C(C)C.
What is the InChIKey of 2,8-dimethylnonane-3,7-dithiol?
The InChIKey is RLOMJCJXMCAJCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24S2/c1-8(2)10(12)6-5-7-11(13)9(3)4/h8-13H,5-7H2,1-4H3.
What are the key properties of 2,8-dimethylnonane-3,7-dithiol?
2,8-dimethylnonane-3,7-dithiol has a molecular weight of 220.45 g/mol, XLogP of 4.07, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethylnonane-3,7-dithiol is sourced from PubChem (CID 57231773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).