C25H38N2O4 — CID 57232189
1-[(2S)-2-[(2S)-2-(1-hydroxy-2-phenoxyethyl)pyrrolidine-1-carbonyl]pyrrolidin-1-yl]octan-1-one (PubChem CID 57232189) has the molecular formula C25H38N2O4 and a molecular weight of 430.59 g/mol. Its IUPAC name is 1-[(2S)-2-[(2S)-2-(1-hydroxy-2-phenoxyethyl)pyrrolidine-1-carbonyl]pyrrolidin-1-yl]octan-1-one.
| Compound Name | 1-[(2S)-2-[(2S)-2-(1-hydroxy-2-phenoxyethyl)pyrrolidine-1-carbonyl]pyrrolidin-1-yl]octan-1-one |
|---|---|
| PubChem CID | 57232189 |
| Molecular Formula | C25H38N2O4 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 1-[(2S)-2-[(2S)-2-(1-hydroxy-2-phenoxyethyl)pyrrolidine-1-carbonyl]pyrrolidin-1-yl]octan-1-one |
| SMILES | CCCCCCCC(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(O)COc1ccccc1 |
| InChI | InChI=1S/C25H38N2O4/c1-2-3-4-5-9-16-24(29)26-17-11-15-22(26)25(30)27-18-10-14-21(27)23(28)19-31-20-12-7-6-8-13-20/h6-8,12-13,21-23,28H,2-5,9-11,14-19H2,1H3/t21-,22-,23?/m0/s1 |
| InChIKey | XUOHAWYICNCLPK-OJSMNCEXSA-N |
| XLogP | 3.77 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|