C29H47FO3Si — CID 57232586
(8S,9S,10R,13S,14S)-7-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57232586) has the molecular formula C29H47FO3Si and a molecular weight of 490.78 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-7-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,9S,10R,13S,14S)-7-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57232586 |
| Molecular Formula | C29H47FO3Si |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | (8S,9S,10R,13S,14S)-7-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCC1CC2=CC(=O)CC[C@@H]2[C@H]2C(F)C[C@]3(C)C(=O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C29H47FO3Si/c1-28(2,3)34(5,6)33-15-9-7-8-10-19-16-20-17-21(31)11-12-22(20)27-24(30)18-29(4)23(26(19)27)13-14-25(29)32/h17,19,22-24,26-27H,7-16,18H2,1-6H3/t19?,22-,23-,24?,26-,27-,29-/m0/s1 |
| InChIKey | SZTSQDRCKXRNFR-VDKFAHRGSA-N |
| XLogP | 7.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|