About methyl 2,9-dioxononanoate
methyl 2,9-dioxononanoate (PubChem CID 57232615) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is methyl 2,9-dioxononanoate.
Molecular Properties
| Compound Name | methyl 2,9-dioxononanoate |
| PubChem CID | 57232615 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | methyl 2,9-dioxononanoate |
| SMILES | COC(=O)C(=O)CCCCCCC=O |
| InChI | InChI=1S/C10H16O4/c1-14-10(13)9(12)7-5-3-2-4-6-8-11/h8H,2-7H2,1H3 |
| InChIKey | SMLJBJNBRTTXEJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2,9-dioxononanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,9-dioxononanoate?
The IUPAC name of methyl 2,9-dioxononanoate (CID 57232615) is methyl 2,9-dioxononanoate.
What is the SMILES notation for methyl 2,9-dioxononanoate?
The canonical SMILES for methyl 2,9-dioxononanoate is COC(=O)C(=O)CCCCCCC=O.
What is the InChIKey of methyl 2,9-dioxononanoate?
The InChIKey is SMLJBJNBRTTXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-14-10(13)9(12)7-5-3-2-4-6-8-11/h8H,2-7H2,1H3.
What are the key properties of methyl 2,9-dioxononanoate?
methyl 2,9-dioxononanoate has a molecular weight of 200.23 g/mol, XLogP of 1.27, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,9-dioxononanoate is sourced from PubChem (CID 57232615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).