About ethyl 3H-azepine-7-carboxylate
ethyl 3H-azepine-7-carboxylate (PubChem CID 57232736) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is ethyl 3H-azepine-7-carboxylate.
Molecular Properties
| Compound Name | ethyl 3H-azepine-7-carboxylate |
| PubChem CID | 57232736 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | ethyl 3H-azepine-7-carboxylate |
| SMILES | CCOC(=O)C1=CC=CCC=N1 |
| InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)8-6-4-3-5-7-10-8/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | HLLAJEZABWPRRV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3H-azepine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3H-azepine-7-carboxylate?
The IUPAC name of ethyl 3H-azepine-7-carboxylate (CID 57232736) is ethyl 3H-azepine-7-carboxylate.
What is the SMILES notation for ethyl 3H-azepine-7-carboxylate?
The canonical SMILES for ethyl 3H-azepine-7-carboxylate is CCOC(=O)C1=CC=CCC=N1.
What is the InChIKey of ethyl 3H-azepine-7-carboxylate?
The InChIKey is HLLAJEZABWPRRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-2-12-9(11)8-6-4-3-5-7-10-8/h3-4,6-7H,2,5H2,1H3.
What are the key properties of ethyl 3H-azepine-7-carboxylate?
ethyl 3H-azepine-7-carboxylate has a molecular weight of 165.19 g/mol, XLogP of 1.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3H-azepine-7-carboxylate is sourced from PubChem (CID 57232736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).