C17H30O2 — CID 57233010
(1S,2R,3aS,6aS)-1-(4-hydroxy-5-methyloct-1-enyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 57233010) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (1S,2R,3aS,6aS)-1-(4-hydroxy-5-methyloct-1-enyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | (1S,2R,3aS,6aS)-1-(4-hydroxy-5-methyloct-1-enyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 57233010 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (1S,2R,3aS,6aS)-1-(4-hydroxy-5-methyloct-1-enyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | CCCC(C)C(O)CC=C[C@H]1[C@H]2CCC[C@H]2C[C@H]1O |
| InChI | InChI=1S/C17H30O2/c1-3-6-12(2)16(18)10-5-9-15-14-8-4-7-13(14)11-17(15)19/h5,9,12-19H,3-4,6-8,10-11H2,1-2H3/t12?,13-,14-,15-,16?,17+/m0/s1 |
| InChIKey | WKGYIQFRMQQVAZ-FUVRDDBWSA-N |
| XLogP | 3.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|