C10H16O7 — CID 57233647
2-hydroxy-3-methyl-1-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]but-3-en-1-one (PubChem CID 57233647) has the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. Its IUPAC name is 2-hydroxy-3-methyl-1-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]but-3-en-1-one.
| Compound Name | 2-hydroxy-3-methyl-1-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]but-3-en-1-one |
|---|---|
| PubChem CID | 57233647 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-hydroxy-3-methyl-1-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]but-3-en-1-one |
| SMILES | C=C(C)C(O)C(=O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16O7/c1-3(2)4(11)6(13)9-7(14)5(12)8(15)10(16)17-9/h4-5,7-12,14-16H,1H2,2H3/t4?,5-,7+,8+,9+,10?/m0/s1 |
| InChIKey | KERCDMGLWHRCRD-JWYKOYIOSA-N |
| XLogP | -2.71 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|