C18H22Cl2N2O4 — CID 57233668
1,1-diamino-1-(3-chlorophenoxy)-2-[(3-chlorophenoxy)methyl]pentane-2,3-diol (PubChem CID 57233668) has the molecular formula C18H22Cl2N2O4 and a molecular weight of 401.29 g/mol. Its IUPAC name is 1,1-diamino-1-(3-chlorophenoxy)-2-[(3-chlorophenoxy)methyl]pentane-2,3-diol.
| Compound Name | 1,1-diamino-1-(3-chlorophenoxy)-2-[(3-chlorophenoxy)methyl]pentane-2,3-diol |
|---|---|
| PubChem CID | 57233668 |
| Molecular Formula | C18H22Cl2N2O4 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 1,1-diamino-1-(3-chlorophenoxy)-2-[(3-chlorophenoxy)methyl]pentane-2,3-diol |
| SMILES | CCC(O)C(O)(COc1cccc(Cl)c1)C(N)(N)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H22Cl2N2O4/c1-2-16(23)17(24,11-25-14-7-3-5-12(19)9-14)18(21,22)26-15-8-4-6-13(20)10-15/h3-10,16,23-24H,2,11,21-22H2,1H3 |
| InChIKey | DTYGNPVWKVPVTJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|