C9H9ClFNO — CID 57234037
2-chloro-3-fluoro-N,N-dimethylbenzamide (PubChem CID 57234037) has the molecular formula C9H9ClFNO and a molecular weight of 201.63 g/mol. Its IUPAC name is 2-chloro-3-fluoro-N,N-dimethylbenzamide.
| Compound Name | 2-chloro-3-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 57234037 |
| Molecular Formula | C9H9ClFNO |
| Molecular Weight | 201.63 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-chloro-3-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(F)c1Cl |
| InChI | InChI=1S/C9H9ClFNO/c1-12(2)9(13)6-4-3-5-7(11)8(6)10/h3-5H,1-2H3 |
| InChIKey | BMUSWMKXXAGTQP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.63 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |