About 2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide
2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide (PubChem CID 57234312) has the molecular formula C9H6Cl2N2OS
and a molecular weight of 261.13 g/mol. Its IUPAC name is 2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide.
Molecular Properties
| Compound Name | 2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide |
| PubChem CID | 57234312 |
| Molecular Formula | C9H6Cl2N2OS |
| Molecular Weight | 261.13 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide |
| SMILES | N#CC(S)(C(N)=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H6Cl2N2OS/c10-6-2-1-5(3-7(6)11)9(15,4-12)8(13)14/h1-3,15H,(H2,13,14) |
| InChIKey | DFJAJXZZTRHTPU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.13 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide?
The IUPAC name of 2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide (CID 57234312) is 2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide.
What is the SMILES notation for 2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide?
The canonical SMILES for 2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide is N#CC(S)(C(N)=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide?
The InChIKey is DFJAJXZZTRHTPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Cl2N2OS/c10-6-2-1-5(3-7(6)11)9(15,4-12)8(13)14/h1-3,15H,(H2,13,14).
What are the key properties of 2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide?
2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide has a molecular weight of 261.13 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-2-(3,4-dichlorophenyl)-2-sulfanylacetamide is sourced from PubChem (CID 57234312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).